C13H17FO3S — CID 167531783
(2R,3R,4S,5R,6S)-2-ethyl-4-fluoro-6-phenylsulfanyloxane-3,5-diol (PubChem CID 167531783) has the molecular formula C13H17FO3S and a molecular weight of 272.34 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-ethyl-4-fluoro-6-phenylsulfanyloxane-3,5-diol.
| Compound Name | (2R,3R,4S,5R,6S)-2-ethyl-4-fluoro-6-phenylsulfanyloxane-3,5-diol |
|---|---|
| PubChem CID | 167531783 |
| Molecular Formula | C13H17FO3S |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-ethyl-4-fluoro-6-phenylsulfanyloxane-3,5-diol |
| SMILES | CC[C@H]1O[C@@H](Sc2ccccc2)[C@H](O)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C13H17FO3S/c1-2-9-11(15)10(14)12(16)13(17-9)18-8-6-4-3-5-7-8/h3-7,9-13,15-16H,2H2,1H3/t9-,10+,11-,12-,13+/m1/s1 |
| InChIKey | DCFPHLBTIXPCNI-MLGHIDQZSA-N |
| XLogP | 1.97 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |