C26H17F6NS2 — CID 16753236
4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-5-methyl-2-phenyl-1,3-thiazole (PubChem CID 16753236) has the molecular formula C26H17F6NS2 and a molecular weight of 521.55 g/mol. Its IUPAC name is 4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-5-methyl-2-phenyl-1,3-thiazole.
| Compound Name | 4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-5-methyl-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 16753236 |
| Molecular Formula | C26H17F6NS2 |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | 4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-5-methyl-2-phenyl-1,3-thiazole |
| SMILES | Cc1sc(-c2ccccc2)cc1C1=C(c2nc(-c3ccccc3)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C26H17F6NS2/c1-14-18(13-19(34-14)16-9-5-3-6-10-16)20-21(25(29,30)26(31,32)24(20,27)28)22-15(2)35-23(33-22)17-11-7-4-8-12-17/h3-13H,1-2H3 |
| InChIKey | MNDCPAVLONAWNA-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|