C26H32F2N2O3S3 — CID 167532483
1-cyclopropyl-2-[(5S)-3-[(3,3-difluorocyclobutyl)methylsulfonyl]-5-[3-(2,5-dimethylpyrazol-3-yl)-2-sulfanylidenepropyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]ethanone (PubChem CID 167532483) has the molecular formula C26H32F2N2O3S3 and a molecular weight of 554.75 g/mol. Its IUPAC name is 1-cyclopropyl-2-[(5S)-3-[(3,3-difluorocyclobutyl)methylsulfonyl]-5-[3-(2,5-dimethylpyrazol-3-yl)-2-sulfanylidenepropyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]ethanone.
| Compound Name | 1-cyclopropyl-2-[(5S)-3-[(3,3-difluorocyclobutyl)methylsulfonyl]-5-[3-(2,5-dimethylpyrazol-3-yl)-2-sulfanylidenepropyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 167532483 |
| Molecular Formula | C26H32F2N2O3S3 |
| Molecular Weight | 554.75 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | 1-cyclopropyl-2-[(5S)-3-[(3,3-difluorocyclobutyl)methylsulfonyl]-5-[3-(2,5-dimethylpyrazol-3-yl)-2-sulfanylidenepropyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]ethanone |
| SMILES | Cc1cc(CC(=S)C[C@H]2CCc3sc(CC(=O)C4CC4)c(S(=O)(=O)CC4CC(F)(F)C4)c3C2)n(C)n1 |
| InChI | InChI=1S/C26H32F2N2O3S3/c1-15-7-19(30(2)29-15)10-20(34)8-16-3-6-23-21(9-16)25(24(35-23)11-22(31)18-4-5-18)36(32,33)14-17-12-26(27,28)13-17/h7,16-18H,3-6,8-14H2,1-2H3/t16-/m1/s1 |
| InChIKey | ADSVULXKSWLGBS-MRXNPFEDSA-N |
| XLogP | 5.24 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.75 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|