C11H8F2N4O4S — CID 167532506
N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-2-nitro-1,3-thiazole-5-carboxamide (PubChem CID 167532506) has the molecular formula C11H8F2N4O4S and a molecular weight of 330.27 g/mol. Its IUPAC name is N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-2-nitro-1,3-thiazole-5-carboxamide.
| Compound Name | N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-2-nitro-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 167532506 |
| Molecular Formula | C11H8F2N4O4S |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-2-nitro-1,3-thiazole-5-carboxamide |
| SMILES | O=C(Nc1cc(F)c(=O)n(CCF)c1)c1cnc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H8F2N4O4S/c12-1-2-16-5-6(3-7(13)10(16)19)15-9(18)8-4-14-11(22-8)17(20)21/h3-5H,1-2H2,(H,15,18) |
| InChIKey | MKFZBYUZMZMIGI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|