About (3S)-3-(5-methyl-1,3-thiazol-2-yl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid;sulfane
(3S)-3-(5-methyl-1,3-thiazol-2-yl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid;sulfane (PubChem CID 167532571) has the molecular formula C11H14F3NO2S2
and a molecular weight of 313.37 g/mol. Its IUPAC name is (3S)-3-(5-methyl-1,3-thiazol-2-yl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid;sulfane.
Molecular Properties
| Compound Name | (3S)-3-(5-methyl-1,3-thiazol-2-yl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid;sulfane |
| PubChem CID | 167532571 |
| Molecular Formula | C11H14F3NO2S2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | (3S)-3-(5-methyl-1,3-thiazol-2-yl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid;sulfane |
| SMILES | Cc1cnc([C@@H](CC(=O)O)C2(C(F)(F)F)CC2)s1.S |
| InChI | InChI=1S/C11H12F3NO2S.H2S/c1-6-5-15-9(18-6)7(4-8(16)17)10(2-3-10)11(12,13)14;/h5,7H,2-4H2,1H3,(H,16,17);1H2/t7-;/m1./s1 |
| InChIKey | AECGPIKKMNCCOK-OGFXRTJISA-N |
| XLogP | 3.47 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-(5-methyl-1,3-thiazol-2-yl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(5-methyl-1,3-thiazol-2-yl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid;sulfane?
The IUPAC name of (3S)-3-(5-methyl-1,3-thiazol-2-yl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid;sulfane (CID 167532571) is (3S)-3-(5-methyl-1,3-thiazol-2-yl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid;sulfane.
What is the SMILES notation for (3S)-3-(5-methyl-1,3-thiazol-2-yl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid;sulfane?
The canonical SMILES for (3S)-3-(5-methyl-1,3-thiazol-2-yl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid;sulfane is Cc1cnc([C@@H](CC(=O)O)C2(C(F)(F)F)CC2)s1.S.
What is the InChIKey of (3S)-3-(5-methyl-1,3-thiazol-2-yl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid;sulfane?
The InChIKey is AECGPIKKMNCCOK-OGFXRTJISA-N. The full InChI is InChI=1S/C11H12F3NO2S.H2S/c1-6-5-15-9(18-6)7(4-8(16)17)10(2-3-10)11(12,13)14;/h5,7H,2-4H2,1H3,(H,16,17);1H2/t7-;/m1./s1.
What are the key properties of (3S)-3-(5-methyl-1,3-thiazol-2-yl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid;sulfane?
(3S)-3-(5-methyl-1,3-thiazol-2-yl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid;sulfane has a molecular weight of 313.37 g/mol, XLogP of 3.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(5-methyl-1,3-thiazol-2-yl)-3-[1-(trifluoromethyl)cyclopropyl]propanoic acid;sulfane is sourced from PubChem (CID 167532571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).