C21H29FO2 — CID 167533116
(4-fluoro-2-propan-2-ylphenyl)methanol;(4-methyl-2-propan-2-ylphenyl)methanol (PubChem CID 167533116) has the molecular formula C21H29FO2 and a molecular weight of 332.46 g/mol. Its IUPAC name is (4-fluoro-2-propan-2-ylphenyl)methanol;(4-methyl-2-propan-2-ylphenyl)methanol.
| Compound Name | (4-fluoro-2-propan-2-ylphenyl)methanol;(4-methyl-2-propan-2-ylphenyl)methanol |
|---|---|
| PubChem CID | 167533116 |
| Molecular Formula | C21H29FO2 |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | (4-fluoro-2-propan-2-ylphenyl)methanol;(4-methyl-2-propan-2-ylphenyl)methanol |
| SMILES | CC(C)c1cc(F)ccc1CO.Cc1ccc(CO)c(C(C)C)c1 |
| InChI | InChI=1S/C11H16O.C10H13FO/c1-8(2)11-6-9(3)4-5-10(11)7-12;1-7(2)10-5-9(11)4-3-8(10)6-12/h4-6,8,12H,7H2,1-3H3;3-5,7,12H,6H2,1-2H3 |
| InChIKey | AFSLQMWZHAEALK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |