C22H34O6 — CID 16753560
(E,1S)-1-[(2S,4aS,6R,8aR)-2-[(E,1R)-1-hydroxy-3-oxohex-4-enyl]-2,6-dimethyl-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran-6-yl]-1-hydroxyhex-4-en-3-one (PubChem CID 16753560) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is (E,1S)-1-[(2S,4aS,6R,8aR)-2-[(E,1R)-1-hydroxy-3-oxohex-4-enyl]-2,6-dimethyl-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran-6-yl]-1-hydroxyhex-4-en-3-one.
| Compound Name | (E,1S)-1-[(2S,4aS,6R,8aR)-2-[(E,1R)-1-hydroxy-3-oxohex-4-enyl]-2,6-dimethyl-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran-6-yl]-1-hydroxyhex-4-en-3-one |
|---|---|
| PubChem CID | 16753560 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (E,1S)-1-[(2S,4aS,6R,8aR)-2-[(E,1R)-1-hydroxy-3-oxohex-4-enyl]-2,6-dimethyl-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran-6-yl]-1-hydroxyhex-4-en-3-one |
| SMILES | C/C=C/C(=O)C[C@@H](O)[C@]1(C)CC[C@@H]2O[C@@](C)([C@@H](O)CC(=O)/C=C/C)CC[C@H]2O1 |
| InChI | InChI=1S/C22H34O6/c1-5-7-15(23)13-19(25)21(3)11-9-18-17(27-21)10-12-22(4,28-18)20(26)14-16(24)8-6-2/h5-8,17-20,25-26H,9-14H2,1-4H3/b7-5+,8-6+/t17-,18+,19-,20+,21+,22- |
| InChIKey | HLMFCZJBSRJJFH-ZOUVGULCSA-N |
| XLogP | 2.65 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|