C28H28O2 — CID 16753688
(1S,3S,3aR,6R,7aS)-3a-methyl-1-naphthalen-2-yl-3-phenyl-6-prop-1-en-2-yl-1,3,5,6,7,7a-hexahydro-2-benzofuran-4-one (PubChem CID 16753688) has the molecular formula C28H28O2 and a molecular weight of 396.53 g/mol. Its IUPAC name is (1S,3S,3aR,6R,7aS)-3a-methyl-1-naphthalen-2-yl-3-phenyl-6-prop-1-en-2-yl-1,3,5,6,7,7a-hexahydro-2-benzofuran-4-one.
| Compound Name | (1S,3S,3aR,6R,7aS)-3a-methyl-1-naphthalen-2-yl-3-phenyl-6-prop-1-en-2-yl-1,3,5,6,7,7a-hexahydro-2-benzofuran-4-one |
|---|---|
| PubChem CID | 16753688 |
| Molecular Formula | C28H28O2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | (1S,3S,3aR,6R,7aS)-3a-methyl-1-naphthalen-2-yl-3-phenyl-6-prop-1-en-2-yl-1,3,5,6,7,7a-hexahydro-2-benzofuran-4-one |
| SMILES | C=C(C)[C@H]1CC(=O)[C@]2(C)[C@H](C1)[C@@H](c1ccc3ccccc3c1)O[C@H]2c1ccccc1 |
| InChI | InChI=1S/C28H28O2/c1-18(2)23-16-24-26(22-14-13-19-9-7-8-12-21(19)15-22)30-27(20-10-5-4-6-11-20)28(24,3)25(29)17-23/h4-15,23-24,26-27H,1,16-17H2,2-3H3/t23-,24-,26-,27+,28+/m1/s1 |
| InChIKey | OHERNHIPGKYNTQ-VBHOFJLSSA-N |
| XLogP | 6.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|