About CID 167536953
CID 167536953 (PubChem CID 167536953) has the molecular formula C46H45BBrF2N6O6
and a molecular weight of 906.61 g/mol.
Molecular Properties
| Compound Name | CID 167536953 |
| PubChem CID | 167536953 |
| Molecular Formula | C46H45BBrF2N6O6 |
| Molecular Weight | 906.61 g/mol |
| Exact Mass | 905.26 |
| IUPAC Name | — |
| SMILES | Cc1ccc(O[C@H]2CCN(c3ccc(-c4ccc(F)cc4)cc3C(N)=O)C2)nc1.Cc1ccc(O[C@H]2CCN(c3ccc(Br)cc3C(N)=O)C2)nc1.O[B]Oc1ccc(F)cc1 |
| InChI | InChI=1S/C23H22FN3O2.C17H18BrN3O2.C6H5BFO2/c1-15-2-9-22(26-13-15)29-19-10-11-27(14-19)21-8-5-17(12-20(21)23(25)28)16-3-6-18(24)7-4-16;1-11-2-5-16(20-9-11)23-13-6-7-21(10-13)15-4-3-12(18)8-14(15)17(19)22;8-5-1-3-6(4-2-5)10-7-9/h2-9,12-13,19H,10-11,14H2,1H3,(H2,25,28);2-5,8-9,13H,6-7,10H2,1H3,(H2,19,22);1-4,9H/t19-;13-;/m00./s1 |
| InChIKey | SRORXOCPKNJLBP-OVNKVOPASA-N |
| XLogP | 7.59 |
| TPSA | 166.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 906.61 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 167536953 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167536953?
The IUPAC name of CID 167536953 (CID 167536953) is not available.
What is the SMILES notation for CID 167536953?
The canonical SMILES for CID 167536953 is Cc1ccc(O[C@H]2CCN(c3ccc(-c4ccc(F)cc4)cc3C(N)=O)C2)nc1.Cc1ccc(O[C@H]2CCN(c3ccc(Br)cc3C(N)=O)C2)nc1.O[B]Oc1ccc(F)cc1.
What is the InChIKey of CID 167536953?
The InChIKey is SRORXOCPKNJLBP-OVNKVOPASA-N. The full InChI is InChI=1S/C23H22FN3O2.C17H18BrN3O2.C6H5BFO2/c1-15-2-9-22(26-13-15)29-19-10-11-27(14-19)21-8-5-17(12-20(21)23(25)28)16-3-6-18(24)7-4-16;1-11-2-5-16(20-9-11)23-13-6-7-21(10-13)15-4-3-12(18)8-14(15)17(19)22;8-5-1-3-6(4-2-5)10-7-9/h2-9,12-13,19H,10-11,14H2,1H3,(H2,25,28);2-5,8-9,13H,6-7,10H2,1H3,(H2,19,22);1-4,9H/t19-;13-;/m00./s1.
What are the key properties of CID 167536953?
CID 167536953 has a molecular weight of 906.61 g/mol, XLogP of 7.59, 11 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167536953 is sourced from PubChem (CID 167536953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).