About (2,5-dioxopyrrolidin-1-yl) (2R)-2-(2,5-dioxopyrrol-1-yl)-3-(2-tritioethylamino)propanoate
(2,5-dioxopyrrolidin-1-yl) (2R)-2-(2,5-dioxopyrrol-1-yl)-3-(2-tritioethylamino)propanoate (PubChem CID 167537197) has the molecular formula C13H15N3O6
and a molecular weight of 311.29 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2R)-2-(2,5-dioxopyrrol-1-yl)-3-(2-tritioethylamino)propanoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2R)-2-(2,5-dioxopyrrol-1-yl)-3-(2-tritioethylamino)propanoate |
| PubChem CID | 167537197 |
| Molecular Formula | C13H15N3O6 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2R)-2-(2,5-dioxopyrrol-1-yl)-3-(2-tritioethylamino)propanoate |
| SMILES | [3H]CCNC[C@H](C(=O)ON1C(=O)CCC1=O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H15N3O6/c1-2-14-7-8(15-9(17)3-4-10(15)18)13(21)22-16-11(19)5-6-12(16)20/h3-4,8,14H,2,5-7H2,1H3/t8-/m1/s1/i1T |
| InChIKey | ASAJARITBDQFGI-HEDNYKPASA-N |
| XLogP | -1.50 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) (2R)-2-(2,5-dioxopyrrol-1-yl)-3-(2-tritioethylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) (2R)-2-(2,5-dioxopyrrol-1-yl)-3-(2-tritioethylamino)propanoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) (2R)-2-(2,5-dioxopyrrol-1-yl)-3-(2-tritioethylamino)propanoate (CID 167537197) is (2,5-dioxopyrrolidin-1-yl) (2R)-2-(2,5-dioxopyrrol-1-yl)-3-(2-tritioethylamino)propanoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) (2R)-2-(2,5-dioxopyrrol-1-yl)-3-(2-tritioethylamino)propanoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) (2R)-2-(2,5-dioxopyrrol-1-yl)-3-(2-tritioethylamino)propanoate is [3H]CCNC[C@H](C(=O)ON1C(=O)CCC1=O)N1C(=O)C=CC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) (2R)-2-(2,5-dioxopyrrol-1-yl)-3-(2-tritioethylamino)propanoate?
The InChIKey is ASAJARITBDQFGI-HEDNYKPASA-N. The full InChI is InChI=1S/C13H15N3O6/c1-2-14-7-8(15-9(17)3-4-10(15)18)13(21)22-16-11(19)5-6-12(16)20/h3-4,8,14H,2,5-7H2,1H3/t8-/m1/s1/i1T.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) (2R)-2-(2,5-dioxopyrrol-1-yl)-3-(2-tritioethylamino)propanoate?
(2,5-dioxopyrrolidin-1-yl) (2R)-2-(2,5-dioxopyrrol-1-yl)-3-(2-tritioethylamino)propanoate has a molecular weight of 311.29 g/mol, XLogP of -1.50, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) (2R)-2-(2,5-dioxopyrrol-1-yl)-3-(2-tritioethylamino)propanoate is sourced from PubChem (CID 167537197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).