C71H44B3F18O21S3-3 — CID 167537522
CID 167537522 (PubChem CID 167537522) has the molecular formula C71H44B3F18O21S3-3 and a molecular weight of 1703.71 g/mol.
| Compound Name | CID 167537522 |
|---|---|
| PubChem CID | 167537522 |
| Molecular Formula | C71H44B3F18O21S3-3 |
| Molecular Weight | 1703.71 g/mol |
| Exact Mass | 1703.15 |
| IUPAC Name | — |
| SMILES | [B]Cc1ccc(C(=O)OC(CS(=O)(=O)[O-])(C(F)(F)F)C(F)(F)F)c(OC(=O)C2C=Cc3ccccc32)c1.[B]Cc1ccc(C(=O)OC(CS(=O)(=O)[O-])(C(F)(F)F)C(F)(F)F)c(OC(=O)C2c3ccccc3-c3ccccc32)c1.[B]Cc1ccc(C(=O)OC(CS(=O)(=O)[O-])(C(F)(F)F)C(F)(F)F)c(OC(=O)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C26H17BF6O7S.C23H15BF6O7S.C22H15BF6O7S/c27-12-14-9-10-19(22(34)40-24(25(28,29)30,26(31,32)33)13-41(36,37)38)20(11-14)39-23(35)21-17-7-3-1-5-15(17)16-6-2-4-8-18(16)21;24-11-13-8-9-17(20(32)37-21(22(25,26)27,23(28,29)30)12-38(33,34)35)18(10-13)36-19(31)16-7-3-5-14-4-1-2-6-15(14)16;23-10-12-5-7-16(17(9-12)35-18(30)15-8-6-13-3-1-2-4-14(13)15)19(31)36-20(21(24,25)26,22(27,28)29)11-37(32,33)34/h1-11,21H,12-13H2,(H,36,37,38);1-10H,11-12H2,(H,33,34,35);1-9,15H,10-11H2,(H,32,33,34)/p-3 |
| InChIKey | UHCSQUFFYDGDBS-UHFFFAOYSA-K |
| XLogP | 12.57 |
| TPSA | 329.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 116 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1703.71 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|