About 9-(4-methoxy-2,6-dimethylphenyl)thioxanthen-9-ol
9-(4-methoxy-2,6-dimethylphenyl)thioxanthen-9-ol (PubChem CID 16753799) has the molecular formula C22H20O2S
and a molecular weight of 348.47 g/mol. Its IUPAC name is 9-(4-methoxy-2,6-dimethylphenyl)thioxanthen-9-ol.
Molecular Properties
| Compound Name | 9-(4-methoxy-2,6-dimethylphenyl)thioxanthen-9-ol |
| PubChem CID | 16753799 |
| Molecular Formula | C22H20O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 9-(4-methoxy-2,6-dimethylphenyl)thioxanthen-9-ol |
| SMILES | COc1cc(C)c(C2(O)c3ccccc3Sc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C22H20O2S/c1-14-12-16(24-3)13-15(2)21(14)22(23)17-8-4-6-10-19(17)25-20-11-7-5-9-18(20)22/h4-13,23H,1-3H3 |
| InChIKey | KPXCCWFBEUQJLT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-(4-methoxy-2,6-dimethylphenyl)thioxanthen-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4-methoxy-2,6-dimethylphenyl)thioxanthen-9-ol?
The IUPAC name of 9-(4-methoxy-2,6-dimethylphenyl)thioxanthen-9-ol (CID 16753799) is 9-(4-methoxy-2,6-dimethylphenyl)thioxanthen-9-ol.
What is the SMILES notation for 9-(4-methoxy-2,6-dimethylphenyl)thioxanthen-9-ol?
The canonical SMILES for 9-(4-methoxy-2,6-dimethylphenyl)thioxanthen-9-ol is COc1cc(C)c(C2(O)c3ccccc3Sc3ccccc32)c(C)c1.
What is the InChIKey of 9-(4-methoxy-2,6-dimethylphenyl)thioxanthen-9-ol?
The InChIKey is KPXCCWFBEUQJLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20O2S/c1-14-12-16(24-3)13-15(2)21(14)22(23)17-8-4-6-10-19(17)25-20-11-7-5-9-18(20)22/h4-13,23H,1-3H3.
What are the key properties of 9-(4-methoxy-2,6-dimethylphenyl)thioxanthen-9-ol?
9-(4-methoxy-2,6-dimethylphenyl)thioxanthen-9-ol has a molecular weight of 348.47 g/mol, XLogP of 5.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4-methoxy-2,6-dimethylphenyl)thioxanthen-9-ol is sourced from PubChem (CID 16753799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).