C23H17FN2O4S — CID 167538185
3-[[5-cyano-2-(3-fluoro-2-pyridinyl)phenyl]methylsulfonyl]-4-cyclopropylbenzoic acid (PubChem CID 167538185) has the molecular formula C23H17FN2O4S and a molecular weight of 436.46 g/mol. Its IUPAC name is 3-[[5-cyano-2-(3-fluoro-2-pyridinyl)phenyl]methylsulfonyl]-4-cyclopropylbenzoic acid.
| Compound Name | 3-[[5-cyano-2-(3-fluoro-2-pyridinyl)phenyl]methylsulfonyl]-4-cyclopropylbenzoic acid |
|---|---|
| PubChem CID | 167538185 |
| Molecular Formula | C23H17FN2O4S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 3-[[5-cyano-2-(3-fluoro-2-pyridinyl)phenyl]methylsulfonyl]-4-cyclopropylbenzoic acid |
| SMILES | N#Cc1ccc(-c2ncccc2F)c(CS(=O)(=O)c2cc(C(=O)O)ccc2C2CC2)c1 |
| InChI | InChI=1S/C23H17FN2O4S/c24-20-2-1-9-26-22(20)19-7-3-14(12-25)10-17(19)13-31(29,30)21-11-16(23(27)28)6-8-18(21)15-4-5-15/h1-3,6-11,15H,4-5,13H2,(H,27,28) |
| InChIKey | WAMHNTKUPBPEEV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |