C25H20F3N5 — CID 167538735
5-[5-[2-[1-(1,1-difluoroethyl)cyclopropyl]ethynyl]-3,4-dihydro-2H-quinolin-1-yl]-7-fluoro-[1,2,4]triazolo[4,3-a]quinazoline (PubChem CID 167538735) has the molecular formula C25H20F3N5 and a molecular weight of 447.46 g/mol. Its IUPAC name is 5-[5-[2-[1-(1,1-difluoroethyl)cyclopropyl]ethynyl]-3,4-dihydro-2H-quinolin-1-yl]-7-fluoro-[1,2,4]triazolo[4,3-a]quinazoline.
| Compound Name | 5-[5-[2-[1-(1,1-difluoroethyl)cyclopropyl]ethynyl]-3,4-dihydro-2H-quinolin-1-yl]-7-fluoro-[1,2,4]triazolo[4,3-a]quinazoline |
|---|---|
| PubChem CID | 167538735 |
| Molecular Formula | C25H20F3N5 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 5-[5-[2-[1-(1,1-difluoroethyl)cyclopropyl]ethynyl]-3,4-dihydro-2H-quinolin-1-yl]-7-fluoro-[1,2,4]triazolo[4,3-a]quinazoline |
| SMILES | CC(F)(F)C1(C#Cc2cccc3c2CCCN3c2nc3nncn3c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C25H20F3N5/c1-24(27,28)25(11-12-25)10-9-16-4-2-6-20-18(16)5-3-13-32(20)22-19-14-17(26)7-8-21(19)33-15-29-31-23(33)30-22/h2,4,6-8,14-15H,3,5,11-13H2,1H3 |
| InChIKey | AWTBPRYLQNRKDW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|