C35H38N2O3 — CID 16753894
(4S)-4-propan-2-yl-2-[[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-[9-(2,4,6-trimethylphenyl)xanthen-3-ylidene]methyl]-4,5-dihydro-1,3-oxazole (PubChem CID 16753894) has the molecular formula C35H38N2O3 and a molecular weight of 534.70 g/mol. Its IUPAC name is (4S)-4-propan-2-yl-2-[[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-[9-(2,4,6-trimethylphenyl)xanthen-3-ylidene]methyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-4-propan-2-yl-2-[[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-[9-(2,4,6-trimethylphenyl)xanthen-3-ylidene]methyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 16753894 |
| Molecular Formula | C35H38N2O3 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | (4S)-4-propan-2-yl-2-[[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-[9-(2,4,6-trimethylphenyl)xanthen-3-ylidene]methyl]-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1cc(C)c(C2=c3ccc(=C(C4=N[C@@H](C(C)C)CO4)C4=N[C@@H](C(C)C)CO4)cc3Oc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C35H38N2O3/c1-19(2)27-17-38-34(36-27)32(35-37-28(18-39-35)20(3)4)24-12-13-26-30(16-24)40-29-11-9-8-10-25(29)33(26)31-22(6)14-21(5)15-23(31)7/h8-16,19-20,27-28H,17-18H2,1-7H3/t27-,28-/m1/s1 |
| InChIKey | DPIVZDRIXGEUTM-VSGBNLITSA-N |
| XLogP | 6.02 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |