C25H25N5O3 — CID 167539002
1-[4-(hydroxymethyl)phenyl]-3-[4-(6-morpholin-4-yl-7H-purin-2-yl)phenyl]propan-2-one (PubChem CID 167539002) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is 1-[4-(hydroxymethyl)phenyl]-3-[4-(6-morpholin-4-yl-7H-purin-2-yl)phenyl]propan-2-one.
| Compound Name | 1-[4-(hydroxymethyl)phenyl]-3-[4-(6-morpholin-4-yl-7H-purin-2-yl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 167539002 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 1-[4-(hydroxymethyl)phenyl]-3-[4-(6-morpholin-4-yl-7H-purin-2-yl)phenyl]propan-2-one |
| SMILES | O=C(Cc1ccc(CO)cc1)Cc1ccc(-c2nc(N3CCOCC3)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C25H25N5O3/c31-15-19-3-1-17(2-4-19)13-21(32)14-18-5-7-20(8-6-18)23-28-24-22(26-16-27-24)25(29-23)30-9-11-33-12-10-30/h1-8,16,31H,9-15H2,(H,26,27,28,29) |
| InChIKey | OPMQRWVQWZOPHA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 104.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |