C17H21NO4 — CID 167539160
5-oxo-2-[[(E)-3-phenylprop-2-enoyl]amino]octanoic acid (PubChem CID 167539160) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 5-oxo-2-[[(E)-3-phenylprop-2-enoyl]amino]octanoic acid.
| Compound Name | 5-oxo-2-[[(E)-3-phenylprop-2-enoyl]amino]octanoic acid |
|---|---|
| PubChem CID | 167539160 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 5-oxo-2-[[(E)-3-phenylprop-2-enoyl]amino]octanoic acid |
| SMILES | CCCC(=O)CCC(NC(=O)/C=C/c1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H21NO4/c1-2-6-14(19)10-11-15(17(21)22)18-16(20)12-9-13-7-4-3-5-8-13/h3-5,7-9,12,15H,2,6,10-11H2,1H3,(H,18,20)(H,21,22)/b12-9+ |
| InChIKey | AYDTVEQYSBCYLE-FMIVXFBMSA-N |
| XLogP | 2.42 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|