C20H17F3N6O3 — CID 167540695
7-(3-azidopyrrolidin-1-yl)-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid;methane (PubChem CID 167540695) has the molecular formula C20H17F3N6O3 and a molecular weight of 446.39 g/mol. Its IUPAC name is 7-(3-azidopyrrolidin-1-yl)-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid;methane.
| Compound Name | 7-(3-azidopyrrolidin-1-yl)-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid;methane |
|---|---|
| PubChem CID | 167540695 |
| Molecular Formula | C20H17F3N6O3 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 7-(3-azidopyrrolidin-1-yl)-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid;methane |
| SMILES | C.[N-]=[N+]=NC1CCN(c2nc3c(cc2F)c(=O)c(C(=O)O)cn3-c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C19H13F3N6O3.CH4/c20-9-1-2-15(13(21)5-9)28-8-12(19(30)31)16(29)11-6-14(22)18(24-17(11)28)27-4-3-10(7-27)25-26-23;/h1-2,5-6,8,10H,3-4,7H2,(H,30,31);1H4 |
| InChIKey | BDQCORBGBDATBP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 124.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|