C18H35BrO4Si — CID 16754072
[(3R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-7-oxoheptan-3-yl] 2-bromopropanoate (PubChem CID 16754072) has the molecular formula C18H35BrO4Si and a molecular weight of 423.46 g/mol. Its IUPAC name is [(3R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-7-oxoheptan-3-yl] 2-bromopropanoate.
| Compound Name | [(3R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-7-oxoheptan-3-yl] 2-bromopropanoate |
|---|---|
| PubChem CID | 16754072 |
| Molecular Formula | C18H35BrO4Si |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | [(3R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-7-oxoheptan-3-yl] 2-bromopropanoate |
| SMILES | CC[C@@H](OC(=O)C(C)Br)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C=O |
| InChI | InChI=1S/C18H35BrO4Si/c1-10-15(22-17(21)14(4)19)13(3)16(12(2)11-20)23-24(8,9)18(5,6)7/h11-16H,10H2,1-9H3/t12-,13+,14?,15-,16+/m1/s1 |
| InChIKey | RFDDSPLWVNVEPG-FVPDABNVSA-N |
| XLogP | 4.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|