C28H39N3O6 — CID 167541020
tert-butyl 4-[1-[3-(2,4-dioxopiperidin-1-yl)-4-methylbenzoyl]piperidin-4-yl]oxypiperidine-1-carboxylate (PubChem CID 167541020) has the molecular formula C28H39N3O6 and a molecular weight of 513.64 g/mol. Its IUPAC name is tert-butyl 4-[1-[3-(2,4-dioxopiperidin-1-yl)-4-methylbenzoyl]piperidin-4-yl]oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[3-(2,4-dioxopiperidin-1-yl)-4-methylbenzoyl]piperidin-4-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 167541020 |
| Molecular Formula | C28H39N3O6 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | tert-butyl 4-[1-[3-(2,4-dioxopiperidin-1-yl)-4-methylbenzoyl]piperidin-4-yl]oxypiperidine-1-carboxylate |
| SMILES | Cc1ccc(C(=O)N2CCC(OC3CCN(C(=O)OC(C)(C)C)CC3)CC2)cc1N1CCC(=O)CC1=O |
| InChI | InChI=1S/C28H39N3O6/c1-19-5-6-20(17-24(19)31-16-7-21(32)18-25(31)33)26(34)29-12-8-22(9-13-29)36-23-10-14-30(15-11-23)27(35)37-28(2,3)4/h5-6,17,22-23H,7-16,18H2,1-4H3 |
| InChIKey | BEQHYTIZWZLPRY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|