C36H71N5 — CID 167541095
5-tert-butyl-2-[(1-tert-butylpiperidin-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;2,8-ditert-butyl-2,8-diazaspiro[4.5]decane (PubChem CID 167541095) has the molecular formula C36H71N5 and a molecular weight of 574.00 g/mol. Its IUPAC name is 5-tert-butyl-2-[(1-tert-butylpiperidin-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;2,8-ditert-butyl-2,8-diazaspiro[4.5]decane.
| Compound Name | 5-tert-butyl-2-[(1-tert-butylpiperidin-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;2,8-ditert-butyl-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 167541095 |
| Molecular Formula | C36H71N5 |
| Molecular Weight | 574.00 g/mol |
| Exact Mass | 573.57 |
| IUPAC Name | 5-tert-butyl-2-[(1-tert-butylpiperidin-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;2,8-ditert-butyl-2,8-diazaspiro[4.5]decane |
| SMILES | CC(C)(C)N1CCC(CN2CC3CN(C(C)(C)C)CC3C2)CC1.CC(C)(C)N1CCC2(CC1)CCN(C(C)(C)C)C2 |
| InChI | InChI=1S/C20H39N3.C16H32N2/c1-19(2,3)22-9-7-16(8-10-22)11-21-12-17-14-23(20(4,5)6)15-18(17)13-21;1-14(2,3)17-10-7-16(8-11-17)9-12-18(13-16)15(4,5)6/h16-18H,7-15H2,1-6H3;7-13H2,1-6H3 |
| InChIKey | BEWVIWHQXSKBIB-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 16.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.00 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |