C20H22O3 — CID 16754159
(E)-1-(2,6-dimethoxyphenyl)-3-(2,4,6-trimethylphenyl)prop-2-en-1-one (PubChem CID 16754159) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is (E)-1-(2,6-dimethoxyphenyl)-3-(2,4,6-trimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,6-dimethoxyphenyl)-3-(2,4,6-trimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 16754159 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (E)-1-(2,6-dimethoxyphenyl)-3-(2,4,6-trimethylphenyl)prop-2-en-1-one |
| SMILES | COc1cccc(OC)c1C(=O)/C=C/c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C20H22O3/c1-13-11-14(2)16(15(3)12-13)9-10-17(21)20-18(22-4)7-6-8-19(20)23-5/h6-12H,1-5H3/b10-9+ |
| InChIKey | MOJKIVYCXWANRO-MDZDMXLPSA-N |
| XLogP | 4.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|