C27H26ClFN5O8P — CID 167542740
2-amino-9-[2-[[(3-chlorophenyl)methoxy-[[5-(3-fluoro-4-methoxyphenyl)-2-methylidene-1,3-dioxol-4-yl]methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 167542740) has the molecular formula C27H26ClFN5O8P and a molecular weight of 633.96 g/mol. Its IUPAC name is 2-amino-9-[2-[[(3-chlorophenyl)methoxy-[[5-(3-fluoro-4-methoxyphenyl)-2-methylidene-1,3-dioxol-4-yl]methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[(3-chlorophenyl)methoxy-[[5-(3-fluoro-4-methoxyphenyl)-2-methylidene-1,3-dioxol-4-yl]methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 167542740 |
| Molecular Formula | C27H26ClFN5O8P |
| Molecular Weight | 633.96 g/mol |
| Exact Mass | 633.12 |
| IUPAC Name | 2-amino-9-[2-[[(3-chlorophenyl)methoxy-[[5-(3-fluoro-4-methoxyphenyl)-2-methylidene-1,3-dioxol-4-yl]methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | C=C1OC(COP(=O)(COCCn2cnc3c(=O)[nH]c(N)nc32)OCc2cccc(Cl)c2)=C(c2ccc(OC)c(F)c2)O1 |
| InChI | InChI=1S/C27H26ClFN5O8P/c1-16-41-22(24(42-16)18-6-7-21(37-2)20(29)11-18)13-40-43(36,39-12-17-4-3-5-19(28)10-17)15-38-9-8-34-14-31-23-25(34)32-27(30)33-26(23)35/h3-7,10-11,14H,1,8-9,12-13,15H2,2H3,(H3,30,32,33,35) |
| InChIKey | NTDFBBRXDARIJB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 162.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.96 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|