About 1-(2,2-dimethylpropylsulfonyl)-3,3-difluoroazetidine
1-(2,2-dimethylpropylsulfonyl)-3,3-difluoroazetidine (PubChem CID 167544020) has the molecular formula C8H15F2NO2S
and a molecular weight of 227.28 g/mol. Its IUPAC name is 1-(2,2-dimethylpropylsulfonyl)-3,3-difluoroazetidine.
Molecular Properties
| Compound Name | 1-(2,2-dimethylpropylsulfonyl)-3,3-difluoroazetidine |
| PubChem CID | 167544020 |
| Molecular Formula | C8H15F2NO2S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 1-(2,2-dimethylpropylsulfonyl)-3,3-difluoroazetidine |
| SMILES | CC(C)(C)CS(=O)(=O)N1CC(F)(F)C1 |
| InChI | InChI=1S/C8H15F2NO2S/c1-7(2,3)6-14(12,13)11-4-8(9,10)5-11/h4-6H2,1-3H3 |
| InChIKey | HEQSYUHSSLCFGR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,2-dimethylpropylsulfonyl)-3,3-difluoroazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylpropylsulfonyl)-3,3-difluoroazetidine?
The IUPAC name of 1-(2,2-dimethylpropylsulfonyl)-3,3-difluoroazetidine (CID 167544020) is 1-(2,2-dimethylpropylsulfonyl)-3,3-difluoroazetidine.
What is the SMILES notation for 1-(2,2-dimethylpropylsulfonyl)-3,3-difluoroazetidine?
The canonical SMILES for 1-(2,2-dimethylpropylsulfonyl)-3,3-difluoroazetidine is CC(C)(C)CS(=O)(=O)N1CC(F)(F)C1.
What is the InChIKey of 1-(2,2-dimethylpropylsulfonyl)-3,3-difluoroazetidine?
The InChIKey is HEQSYUHSSLCFGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2NO2S/c1-7(2,3)6-14(12,13)11-4-8(9,10)5-11/h4-6H2,1-3H3.
What are the key properties of 1-(2,2-dimethylpropylsulfonyl)-3,3-difluoroazetidine?
1-(2,2-dimethylpropylsulfonyl)-3,3-difluoroazetidine has a molecular weight of 227.28 g/mol, XLogP of 1.31, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylpropylsulfonyl)-3,3-difluoroazetidine is sourced from PubChem (CID 167544020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).