C24H24N2O3 — CID 167544204
2-(cyclohexa-1,3-dien-1-ylmethyl)-3-(3,4-dihydroxyphenyl)-3,5,10,10a-tetrahydroimidazo[1,5-b]isoquinolin-1-one (PubChem CID 167544204) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-(cyclohexa-1,3-dien-1-ylmethyl)-3-(3,4-dihydroxyphenyl)-3,5,10,10a-tetrahydroimidazo[1,5-b]isoquinolin-1-one.
| Compound Name | 2-(cyclohexa-1,3-dien-1-ylmethyl)-3-(3,4-dihydroxyphenyl)-3,5,10,10a-tetrahydroimidazo[1,5-b]isoquinolin-1-one |
|---|---|
| PubChem CID | 167544204 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-(cyclohexa-1,3-dien-1-ylmethyl)-3-(3,4-dihydroxyphenyl)-3,5,10,10a-tetrahydroimidazo[1,5-b]isoquinolin-1-one |
| SMILES | O=C1C2Cc3ccccc3CN2C(c2ccc(O)c(O)c2)N1CC1=CC=CCC1 |
| InChI | InChI=1S/C24H24N2O3/c27-21-11-10-18(13-22(21)28)23-25-15-19-9-5-4-8-17(19)12-20(25)24(29)26(23)14-16-6-2-1-3-7-16/h1-2,4-6,8-11,13,20,23,27-28H,3,7,12,14-15H2 |
| InChIKey | YRJZXMYTUIFUHM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|