About 5-acetyl-4-methoxy-1H-pyrimidin-6-one;1-(4-methoxy-6-methylpyrimidin-5-yl)ethanone
5-acetyl-4-methoxy-1H-pyrimidin-6-one;1-(4-methoxy-6-methylpyrimidin-5-yl)ethanone (PubChem CID 167544580) has the molecular formula C15H18N4O5
and a molecular weight of 334.33 g/mol. Its IUPAC name is 5-acetyl-4-methoxy-1H-pyrimidin-6-one;1-(4-methoxy-6-methylpyrimidin-5-yl)ethanone.
Molecular Properties
| Compound Name | 5-acetyl-4-methoxy-1H-pyrimidin-6-one;1-(4-methoxy-6-methylpyrimidin-5-yl)ethanone |
| PubChem CID | 167544580 |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 5-acetyl-4-methoxy-1H-pyrimidin-6-one;1-(4-methoxy-6-methylpyrimidin-5-yl)ethanone |
| SMILES | COc1nc[nH]c(=O)c1C(C)=O.COc1ncnc(C)c1C(C)=O |
| InChI | InChI=1S/C8H10N2O2.C7H8N2O3/c1-5-7(6(2)11)8(12-3)10-4-9-5;1-4(10)5-6(11)8-3-9-7(5)12-2/h4H,1-3H3;3H,1-2H3,(H,8,9,11) |
| InChIKey | BPVADONUNNLVIN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-acetyl-4-methoxy-1H-pyrimidin-6-one;1-(4-methoxy-6-methylpyrimidin-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-4-methoxy-1H-pyrimidin-6-one;1-(4-methoxy-6-methylpyrimidin-5-yl)ethanone?
The IUPAC name of 5-acetyl-4-methoxy-1H-pyrimidin-6-one;1-(4-methoxy-6-methylpyrimidin-5-yl)ethanone (CID 167544580) is 5-acetyl-4-methoxy-1H-pyrimidin-6-one;1-(4-methoxy-6-methylpyrimidin-5-yl)ethanone.
What is the SMILES notation for 5-acetyl-4-methoxy-1H-pyrimidin-6-one;1-(4-methoxy-6-methylpyrimidin-5-yl)ethanone?
The canonical SMILES for 5-acetyl-4-methoxy-1H-pyrimidin-6-one;1-(4-methoxy-6-methylpyrimidin-5-yl)ethanone is COc1nc[nH]c(=O)c1C(C)=O.COc1ncnc(C)c1C(C)=O.
What is the InChIKey of 5-acetyl-4-methoxy-1H-pyrimidin-6-one;1-(4-methoxy-6-methylpyrimidin-5-yl)ethanone?
The InChIKey is BPVADONUNNLVIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2.C7H8N2O3/c1-5-7(6(2)11)8(12-3)10-4-9-5;1-4(10)5-6(11)8-3-9-7(5)12-2/h4H,1-3H3;3H,1-2H3,(H,8,9,11).
What are the key properties of 5-acetyl-4-methoxy-1H-pyrimidin-6-one;1-(4-methoxy-6-methylpyrimidin-5-yl)ethanone?
5-acetyl-4-methoxy-1H-pyrimidin-6-one;1-(4-methoxy-6-methylpyrimidin-5-yl)ethanone has a molecular weight of 334.33 g/mol, XLogP of 0.98, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-4-methoxy-1H-pyrimidin-6-one;1-(4-methoxy-6-methylpyrimidin-5-yl)ethanone is sourced from PubChem (CID 167544580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).