About CID 16754484
CID 16754484 (PubChem CID 16754484) has the molecular formula C14H22NO
and a molecular weight of 220.34 g/mol.
Molecular Properties
| Compound Name | CID 16754484 |
| PubChem CID | 16754484 |
| Molecular Formula | C14H22NO |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | — |
| SMILES | C=CC[C@H](N[C@H](CO)C(C)C)[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C14H22NO/c1-4-7-13(12-8-5-6-9-12)15-14(10-16)11(2)3/h4-6,8-9,11,13-16H,1,7,10H2,2-3H3/t13-,14+/m0/s1 |
| InChIKey | ZIUANDHRRZHIAQ-UONOGXRCSA-N |
| XLogP | 1.94 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 16754484 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 16754484?
The IUPAC name of CID 16754484 (CID 16754484) is not available.
What is the SMILES notation for CID 16754484?
The canonical SMILES for CID 16754484 is C=CC[C@H](N[C@H](CO)C(C)C)[C]1[CH][CH][CH][CH]1.
What is the InChIKey of CID 16754484?
The InChIKey is ZIUANDHRRZHIAQ-UONOGXRCSA-N. The full InChI is InChI=1S/C14H22NO/c1-4-7-13(12-8-5-6-9-12)15-14(10-16)11(2)3/h4-6,8-9,11,13-16H,1,7,10H2,2-3H3/t13-,14+/m0/s1.
What are the key properties of CID 16754484?
CID 16754484 has a molecular weight of 220.34 g/mol, XLogP of 1.94, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 16754484 is sourced from PubChem (CID 16754484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).