C20H17F3N2O4S — CID 167546402
4-ethyl-3-[[2-imidazol-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid (PubChem CID 167546402) has the molecular formula C20H17F3N2O4S and a molecular weight of 438.43 g/mol. Its IUPAC name is 4-ethyl-3-[[2-imidazol-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid.
| Compound Name | 4-ethyl-3-[[2-imidazol-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 167546402 |
| Molecular Formula | C20H17F3N2O4S |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 4-ethyl-3-[[2-imidazol-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid |
| SMILES | CCc1ccc(C(=O)O)cc1S(=O)(=O)Cc1cc(C(F)(F)F)ccc1-n1ccnc1 |
| InChI | InChI=1S/C20H17F3N2O4S/c1-2-13-3-4-14(19(26)27)10-18(13)30(28,29)11-15-9-16(20(21,22)23)5-6-17(15)25-8-7-24-12-25/h3-10,12H,2,11H2,1H3,(H,26,27) |
| InChIKey | QJXCNFPJEJJPLZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |