C25H22N2O — CID 167547150
N-[(1R)-1-phenylethyl]-3-(quinolin-4-ylmethyl)benzamide (PubChem CID 167547150) has the molecular formula C25H22N2O and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-3-(quinolin-4-ylmethyl)benzamide.
| Compound Name | N-[(1R)-1-phenylethyl]-3-(quinolin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 167547150 |
| Molecular Formula | C25H22N2O |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-3-(quinolin-4-ylmethyl)benzamide |
| SMILES | C[C@@H](NC(=O)c1cccc(Cc2ccnc3ccccc23)c1)c1ccccc1 |
| InChI | InChI=1S/C25H22N2O/c1-18(20-9-3-2-4-10-20)27-25(28)22-11-7-8-19(17-22)16-21-14-15-26-24-13-6-5-12-23(21)24/h2-15,17-18H,16H2,1H3,(H,27,28)/t18-/m1/s1 |
| InChIKey | BXYIPFLCFVQERK-GOSISDBHSA-N |
| XLogP | 5.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |