C34H35BrCl4N2O4 — CID 167547557
1-bromo-3-propan-2-ylbenzene;methyl 3-amino-2,6-dichlorobenzoate;methyl 2,6-dichloro-3-(3-propan-2-ylanilino)benzoate (PubChem CID 167547557) has the molecular formula C34H35BrCl4N2O4 and a molecular weight of 757.38 g/mol. Its IUPAC name is 1-bromo-3-propan-2-ylbenzene;methyl 3-amino-2,6-dichlorobenzoate;methyl 2,6-dichloro-3-(3-propan-2-ylanilino)benzoate.
| Compound Name | 1-bromo-3-propan-2-ylbenzene;methyl 3-amino-2,6-dichlorobenzoate;methyl 2,6-dichloro-3-(3-propan-2-ylanilino)benzoate |
|---|---|
| PubChem CID | 167547557 |
| Molecular Formula | C34H35BrCl4N2O4 |
| Molecular Weight | 757.38 g/mol |
| Exact Mass | 754.05 |
| IUPAC Name | 1-bromo-3-propan-2-ylbenzene;methyl 3-amino-2,6-dichlorobenzoate;methyl 2,6-dichloro-3-(3-propan-2-ylanilino)benzoate |
| SMILES | CC(C)c1cccc(Br)c1.COC(=O)c1c(Cl)ccc(N)c1Cl.COC(=O)c1c(Cl)ccc(Nc2cccc(C(C)C)c2)c1Cl |
| InChI | InChI=1S/C17H17Cl2NO2.C9H11Br.C8H7Cl2NO2/c1-10(2)11-5-4-6-12(9-11)20-14-8-7-13(18)15(16(14)19)17(21)22-3;1-7(2)8-4-3-5-9(10)6-8;1-13-8(12)6-4(9)2-3-5(11)7(6)10/h4-10,20H,1-3H3;3-7H,1-2H3;2-3H,11H2,1H3 |
| InChIKey | BZGXMXCXADLGAN-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.38 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|