C14H17FN6OS — CID 167547715
(2S,3R,4S,5R,6R)-5-azido-2-(azidomethyl)-4-fluoro-3-methyl-6-(4-methylphenyl)sulfanyloxane (PubChem CID 167547715) has the molecular formula C14H17FN6OS and a molecular weight of 336.40 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-5-azido-2-(azidomethyl)-4-fluoro-3-methyl-6-(4-methylphenyl)sulfanyloxane.
| Compound Name | (2S,3R,4S,5R,6R)-5-azido-2-(azidomethyl)-4-fluoro-3-methyl-6-(4-methylphenyl)sulfanyloxane |
|---|---|
| PubChem CID | 167547715 |
| Molecular Formula | C14H17FN6OS |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (2S,3R,4S,5R,6R)-5-azido-2-(azidomethyl)-4-fluoro-3-methyl-6-(4-methylphenyl)sulfanyloxane |
| SMILES | Cc1ccc(S[C@H]2O[C@H](CN=[N+]=[N-])[C@@H](C)[C@H](F)[C@H]2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C14H17FN6OS/c1-8-3-5-10(6-4-8)23-14-13(19-21-17)12(15)9(2)11(22-14)7-18-20-16/h3-6,9,11-14H,7H2,1-2H3/t9-,11-,12+,13-,14-/m1/s1 |
| InChIKey | UPCOTQJACPEFRG-RGCYKPLRSA-N |
| XLogP | 4.78 |
| TPSA | 106.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|