C31H25F2N5O3 — CID 167547725
[(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] 2-[3-methyl-5-[5-[2-(4-phenylphenyl)acetyl]-2-pyridinyl]triazol-4-yl]acetate (PubChem CID 167547725) has the molecular formula C31H25F2N5O3 and a molecular weight of 553.57 g/mol. Its IUPAC name is [(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] 2-[3-methyl-5-[5-[2-(4-phenylphenyl)acetyl]-2-pyridinyl]triazol-4-yl]acetate.
| Compound Name | [(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] 2-[3-methyl-5-[5-[2-(4-phenylphenyl)acetyl]-2-pyridinyl]triazol-4-yl]acetate |
|---|---|
| PubChem CID | 167547725 |
| Molecular Formula | C31H25F2N5O3 |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | [(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] 2-[3-methyl-5-[5-[2-(4-phenylphenyl)acetyl]-2-pyridinyl]triazol-4-yl]acetate |
| SMILES | C[C@@H](OC(=O)Cc1c(-c2ccc(C(=O)Cc3ccc(-c4ccccc4)cc3)cn2)nnn1C)c1cc(F)cnc1F |
| InChI | InChI=1S/C31H25F2N5O3/c1-19(25-15-24(32)18-35-31(25)33)41-29(40)16-27-30(36-37-38(27)2)26-13-12-23(17-34-26)28(39)14-20-8-10-22(11-9-20)21-6-4-3-5-7-21/h3-13,15,17-19H,14,16H2,1-2H3/t19-/m1/s1 |
| InChIKey | WZLHIFVINSVHLK-LJQANCHMSA-N |
| XLogP | 5.49 |
| TPSA | 99.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|