C22H18F3NO4S — CID 167548242
4-ethyl-3-[[2-pyridin-2-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid (PubChem CID 167548242) has the molecular formula C22H18F3NO4S and a molecular weight of 449.45 g/mol. Its IUPAC name is 4-ethyl-3-[[2-pyridin-2-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid.
| Compound Name | 4-ethyl-3-[[2-pyridin-2-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 167548242 |
| Molecular Formula | C22H18F3NO4S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 4-ethyl-3-[[2-pyridin-2-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid |
| SMILES | CCc1ccc(C(=O)O)cc1S(=O)(=O)Cc1cc(C(F)(F)F)ccc1-c1ccccn1 |
| InChI | InChI=1S/C22H18F3NO4S/c1-2-14-6-7-15(21(27)28)12-20(14)31(29,30)13-16-11-17(22(23,24)25)8-9-18(16)19-5-3-4-10-26-19/h3-12H,2,13H2,1H3,(H,27,28) |
| InChIKey | CBMRGKFMTDWIRA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |