C32H54FN3O8 — CID 167548475
[(2R)-2-[[(3R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]-3-methylbutyl] N-[9-(fluoroamino)-8-oxononyl]carbamate (PubChem CID 167548475) has the molecular formula C32H54FN3O8 and a molecular weight of 627.79 g/mol. Its IUPAC name is [(2R)-2-[[(3R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]-3-methylbutyl] N-[9-(fluoroamino)-8-oxononyl]carbamate.
| Compound Name | [(2R)-2-[[(3R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]-3-methylbutyl] N-[9-(fluoroamino)-8-oxononyl]carbamate |
|---|---|
| PubChem CID | 167548475 |
| Molecular Formula | C32H54FN3O8 |
| Molecular Weight | 627.79 g/mol |
| Exact Mass | 627.39 |
| IUPAC Name | [(2R)-2-[[(3R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]-3-methylbutyl] N-[9-(fluoroamino)-8-oxononyl]carbamate |
| SMILES | COC1C(OC(=O)N[C@@H](COC(=O)NCCCCCCCC(=O)CNF)C(C)C)CC[C@]2(CO2)C1C1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C32H54FN3O8/c1-21(2)13-14-26-31(5,44-26)28-27(40-6)25(15-16-32(28)20-42-32)43-30(39)36-24(22(3)4)19-41-29(38)34-17-11-9-7-8-10-12-23(37)18-35-33/h13,22,24-28,35H,7-12,14-20H2,1-6H3,(H,34,38)(H,36,39)/t24-,25?,26+,27?,28?,31?,32-/m0/s1 |
| InChIKey | CCFRZBOIROVILD-PXALTOTRSA-N |
| XLogP | 4.92 |
| TPSA | 140.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.79 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|