About (4S)-2,2,4-trimethyl-5-methylidene-4-propan-2-ylpyrrolidine
(4S)-2,2,4-trimethyl-5-methylidene-4-propan-2-ylpyrrolidine (PubChem CID 167551929) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is (4S)-2,2,4-trimethyl-5-methylidene-4-propan-2-ylpyrrolidine.
Molecular Properties
| Compound Name | (4S)-2,2,4-trimethyl-5-methylidene-4-propan-2-ylpyrrolidine |
| PubChem CID | 167551929 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (4S)-2,2,4-trimethyl-5-methylidene-4-propan-2-ylpyrrolidine |
| SMILES | C=C1NC(C)(C)C[C@@]1(C)C(C)C |
| InChI | InChI=1S/C11H21N/c1-8(2)11(6)7-10(4,5)12-9(11)3/h8,12H,3,7H2,1-2,4-6H3/t11-/m0/s1 |
| InChIKey | AVKXBWQDZXBQAA-NSHDSACASA-N |
| XLogP | 2.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-2,2,4-trimethyl-5-methylidene-4-propan-2-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,2,4-trimethyl-5-methylidene-4-propan-2-ylpyrrolidine?
The IUPAC name of (4S)-2,2,4-trimethyl-5-methylidene-4-propan-2-ylpyrrolidine (CID 167551929) is (4S)-2,2,4-trimethyl-5-methylidene-4-propan-2-ylpyrrolidine.
What is the SMILES notation for (4S)-2,2,4-trimethyl-5-methylidene-4-propan-2-ylpyrrolidine?
The canonical SMILES for (4S)-2,2,4-trimethyl-5-methylidene-4-propan-2-ylpyrrolidine is C=C1NC(C)(C)C[C@@]1(C)C(C)C.
What is the InChIKey of (4S)-2,2,4-trimethyl-5-methylidene-4-propan-2-ylpyrrolidine?
The InChIKey is AVKXBWQDZXBQAA-NSHDSACASA-N. The full InChI is InChI=1S/C11H21N/c1-8(2)11(6)7-10(4,5)12-9(11)3/h8,12H,3,7H2,1-2,4-6H3/t11-/m0/s1.
What are the key properties of (4S)-2,2,4-trimethyl-5-methylidene-4-propan-2-ylpyrrolidine?
(4S)-2,2,4-trimethyl-5-methylidene-4-propan-2-ylpyrrolidine has a molecular weight of 167.30 g/mol, XLogP of 2.93, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,2,4-trimethyl-5-methylidene-4-propan-2-ylpyrrolidine is sourced from PubChem (CID 167551929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).