C16H18F6O9 — CID 167552733
1-O-methyl 4-O-(2,2,2-trifluoroethyl) 2-[2-[2-(ethoxymethyl)prop-2-enoyloxy]acetyl]oxy-2-(trifluoromethyl)butanedioate (PubChem CID 167552733) has the molecular formula C16H18F6O9 and a molecular weight of 468.30 g/mol. Its IUPAC name is 1-O-methyl 4-O-(2,2,2-trifluoroethyl) 2-[2-[2-(ethoxymethyl)prop-2-enoyloxy]acetyl]oxy-2-(trifluoromethyl)butanedioate.
| Compound Name | 1-O-methyl 4-O-(2,2,2-trifluoroethyl) 2-[2-[2-(ethoxymethyl)prop-2-enoyloxy]acetyl]oxy-2-(trifluoromethyl)butanedioate |
|---|---|
| PubChem CID | 167552733 |
| Molecular Formula | C16H18F6O9 |
| Molecular Weight | 468.30 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 1-O-methyl 4-O-(2,2,2-trifluoroethyl) 2-[2-[2-(ethoxymethyl)prop-2-enoyloxy]acetyl]oxy-2-(trifluoromethyl)butanedioate |
| SMILES | C=C(COCC)C(=O)OCC(=O)OC(CC(=O)OCC(F)(F)F)(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C16H18F6O9/c1-4-28-6-9(2)12(25)29-7-11(24)31-14(13(26)27-3,16(20,21)22)5-10(23)30-8-15(17,18)19/h2,4-8H2,1,3H3 |
| InChIKey | AQQFRTMPTYSTJC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|