C26H27F3N4O3 — CID 167552941
2-[4-[1-[3,5-dimethoxy-4-(4,4,4-trifluorobutanoyl)phenyl]benzimidazol-5-yl]piperidin-1-yl]acetonitrile (PubChem CID 167552941) has the molecular formula C26H27F3N4O3 and a molecular weight of 500.52 g/mol. Its IUPAC name is 2-[4-[1-[3,5-dimethoxy-4-(4,4,4-trifluorobutanoyl)phenyl]benzimidazol-5-yl]piperidin-1-yl]acetonitrile.
| Compound Name | 2-[4-[1-[3,5-dimethoxy-4-(4,4,4-trifluorobutanoyl)phenyl]benzimidazol-5-yl]piperidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 167552941 |
| Molecular Formula | C26H27F3N4O3 |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 2-[4-[1-[3,5-dimethoxy-4-(4,4,4-trifluorobutanoyl)phenyl]benzimidazol-5-yl]piperidin-1-yl]acetonitrile |
| SMILES | COc1cc(-n2cnc3cc(C4CCN(CC#N)CC4)ccc32)cc(OC)c1C(=O)CCC(F)(F)F |
| InChI | InChI=1S/C26H27F3N4O3/c1-35-23-14-19(15-24(36-2)25(23)22(34)5-8-26(27,28)29)33-16-31-20-13-18(3-4-21(20)33)17-6-10-32(11-7-17)12-9-30/h3-4,13-17H,5-8,10-12H2,1-2H3 |
| InChIKey | CQKZOXSLPRDEDH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 80.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|