C13H11BrClNO6S2 — CID 167553401
3-[(5-bromo-2-hydroxyphenyl)sulfonylmethyl]-5-chloro-2-hydroxybenzenesulfonamide (PubChem CID 167553401) has the molecular formula C13H11BrClNO6S2 and a molecular weight of 456.72 g/mol. Its IUPAC name is 3-[(5-bromo-2-hydroxyphenyl)sulfonylmethyl]-5-chloro-2-hydroxybenzenesulfonamide.
| Compound Name | 3-[(5-bromo-2-hydroxyphenyl)sulfonylmethyl]-5-chloro-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 167553401 |
| Molecular Formula | C13H11BrClNO6S2 |
| Molecular Weight | 456.72 g/mol |
| Exact Mass | 454.89 |
| IUPAC Name | 3-[(5-bromo-2-hydroxyphenyl)sulfonylmethyl]-5-chloro-2-hydroxybenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Cl)cc(CS(=O)(=O)c2cc(Br)ccc2O)c1O |
| InChI | InChI=1S/C13H11BrClNO6S2/c14-8-1-2-10(17)11(4-8)23(19,20)6-7-3-9(15)5-12(13(7)18)24(16,21)22/h1-5,17-18H,6H2,(H2,16,21,22) |
| InChIKey | CRVIXJQTTROFCK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.72 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |