About propan-2-yl (3R)-3-(3,5-difluorophenyl)-3-(4-methylsulfanylphenyl)propanoate
propan-2-yl (3R)-3-(3,5-difluorophenyl)-3-(4-methylsulfanylphenyl)propanoate (PubChem CID 16755365) has the molecular formula C19H20F2O2S
and a molecular weight of 350.43 g/mol. Its IUPAC name is propan-2-yl (3R)-3-(3,5-difluorophenyl)-3-(4-methylsulfanylphenyl)propanoate.
Molecular Properties
| Compound Name | propan-2-yl (3R)-3-(3,5-difluorophenyl)-3-(4-methylsulfanylphenyl)propanoate |
| PubChem CID | 16755365 |
| Molecular Formula | C19H20F2O2S |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | propan-2-yl (3R)-3-(3,5-difluorophenyl)-3-(4-methylsulfanylphenyl)propanoate |
| SMILES | CSc1ccc([C@@H](CC(=O)OC(C)C)c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C19H20F2O2S/c1-12(2)23-19(22)11-18(13-4-6-17(24-3)7-5-13)14-8-15(20)10-16(21)9-14/h4-10,12,18H,11H2,1-3H3/t18-/m1/s1 |
| InChIKey | AQPCZJRWMNDNIT-GOSISDBHSA-N |
| XLogP | 5.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl (3R)-3-(3,5-difluorophenyl)-3-(4-methylsulfanylphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (3R)-3-(3,5-difluorophenyl)-3-(4-methylsulfanylphenyl)propanoate?
The IUPAC name of propan-2-yl (3R)-3-(3,5-difluorophenyl)-3-(4-methylsulfanylphenyl)propanoate (CID 16755365) is propan-2-yl (3R)-3-(3,5-difluorophenyl)-3-(4-methylsulfanylphenyl)propanoate.
What is the SMILES notation for propan-2-yl (3R)-3-(3,5-difluorophenyl)-3-(4-methylsulfanylphenyl)propanoate?
The canonical SMILES for propan-2-yl (3R)-3-(3,5-difluorophenyl)-3-(4-methylsulfanylphenyl)propanoate is CSc1ccc([C@@H](CC(=O)OC(C)C)c2cc(F)cc(F)c2)cc1.
What is the InChIKey of propan-2-yl (3R)-3-(3,5-difluorophenyl)-3-(4-methylsulfanylphenyl)propanoate?
The InChIKey is AQPCZJRWMNDNIT-GOSISDBHSA-N. The full InChI is InChI=1S/C19H20F2O2S/c1-12(2)23-19(22)11-18(13-4-6-17(24-3)7-5-13)14-8-15(20)10-16(21)9-14/h4-10,12,18H,11H2,1-3H3/t18-/m1/s1.
What are the key properties of propan-2-yl (3R)-3-(3,5-difluorophenyl)-3-(4-methylsulfanylphenyl)propanoate?
propan-2-yl (3R)-3-(3,5-difluorophenyl)-3-(4-methylsulfanylphenyl)propanoate has a molecular weight of 350.43 g/mol, XLogP of 5.16, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (3R)-3-(3,5-difluorophenyl)-3-(4-methylsulfanylphenyl)propanoate is sourced from PubChem (CID 16755365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).