About benzyl 4-[(1R)-1-(3,5-difluorophenyl)-3-oxo-3-propan-2-yloxypropyl]piperidine-1-carboxylate
benzyl 4-[(1R)-1-(3,5-difluorophenyl)-3-oxo-3-propan-2-yloxypropyl]piperidine-1-carboxylate (PubChem CID 16755397) has the molecular formula C25H29F2NO4
and a molecular weight of 445.51 g/mol. Its IUPAC name is benzyl 4-[(1R)-1-(3,5-difluorophenyl)-3-oxo-3-propan-2-yloxypropyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 4-[(1R)-1-(3,5-difluorophenyl)-3-oxo-3-propan-2-yloxypropyl]piperidine-1-carboxylate |
| PubChem CID | 16755397 |
| Molecular Formula | C25H29F2NO4 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | benzyl 4-[(1R)-1-(3,5-difluorophenyl)-3-oxo-3-propan-2-yloxypropyl]piperidine-1-carboxylate |
| SMILES | CC(C)OC(=O)C[C@@H](c1cc(F)cc(F)c1)C1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C25H29F2NO4/c1-17(2)32-24(29)15-23(20-12-21(26)14-22(27)13-20)19-8-10-28(11-9-19)25(30)31-16-18-6-4-3-5-7-18/h3-7,12-14,17,19,23H,8-11,15-16H2,1-2H3/t23-/m1/s1 |
| InChIKey | RNDQMKJBMWNDKW-HSZRJFAPSA-N |
| XLogP | 5.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl 4-[(1R)-1-(3,5-difluorophenyl)-3-oxo-3-propan-2-yloxypropyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-[(1R)-1-(3,5-difluorophenyl)-3-oxo-3-propan-2-yloxypropyl]piperidine-1-carboxylate?
The IUPAC name of benzyl 4-[(1R)-1-(3,5-difluorophenyl)-3-oxo-3-propan-2-yloxypropyl]piperidine-1-carboxylate (CID 16755397) is benzyl 4-[(1R)-1-(3,5-difluorophenyl)-3-oxo-3-propan-2-yloxypropyl]piperidine-1-carboxylate.
What is the SMILES notation for benzyl 4-[(1R)-1-(3,5-difluorophenyl)-3-oxo-3-propan-2-yloxypropyl]piperidine-1-carboxylate?
The canonical SMILES for benzyl 4-[(1R)-1-(3,5-difluorophenyl)-3-oxo-3-propan-2-yloxypropyl]piperidine-1-carboxylate is CC(C)OC(=O)C[C@@H](c1cc(F)cc(F)c1)C1CCN(C(=O)OCc2ccccc2)CC1.
What is the InChIKey of benzyl 4-[(1R)-1-(3,5-difluorophenyl)-3-oxo-3-propan-2-yloxypropyl]piperidine-1-carboxylate?
The InChIKey is RNDQMKJBMWNDKW-HSZRJFAPSA-N. The full InChI is InChI=1S/C25H29F2NO4/c1-17(2)32-24(29)15-23(20-12-21(26)14-22(27)13-20)19-8-10-28(11-9-19)25(30)31-16-18-6-4-3-5-7-18/h3-7,12-14,17,19,23H,8-11,15-16H2,1-2H3/t23-/m1/s1.
What are the key properties of benzyl 4-[(1R)-1-(3,5-difluorophenyl)-3-oxo-3-propan-2-yloxypropyl]piperidine-1-carboxylate?
benzyl 4-[(1R)-1-(3,5-difluorophenyl)-3-oxo-3-propan-2-yloxypropyl]piperidine-1-carboxylate has a molecular weight of 445.51 g/mol, XLogP of 5.44, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-[(1R)-1-(3,5-difluorophenyl)-3-oxo-3-propan-2-yloxypropyl]piperidine-1-carboxylate is sourced from PubChem (CID 16755397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).