About 2-[(3S)-1-[8-(cyclobutylamino)octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide
2-[(3S)-1-[8-(cyclobutylamino)octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide (PubChem CID 16755438) has the molecular formula C30H43N3O
and a molecular weight of 461.69 g/mol. Its IUPAC name is 2-[(3S)-1-[8-(cyclobutylamino)octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | 2-[(3S)-1-[8-(cyclobutylamino)octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
| PubChem CID | 16755438 |
| Molecular Formula | C30H43N3O |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.34 |
| IUPAC Name | 2-[(3S)-1-[8-(cyclobutylamino)octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
| SMILES | NC(=O)C(c1ccccc1)(c1ccccc1)[C@@H]1CCN(CCCCCCCCNC2CCC2)C1 |
| InChI | InChI=1S/C30H43N3O/c31-29(34)30(25-14-7-5-8-15-25,26-16-9-6-10-17-26)27-20-23-33(24-27)22-12-4-2-1-3-11-21-32-28-18-13-19-28/h5-10,14-17,27-28,32H,1-4,11-13,18-24H2,(H2,31,34)/t27-/m1/s1 |
| InChIKey | GIKPJPDQOSGJIX-HHHXNRCGSA-N |
| XLogP | 5.26 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3S)-1-[8-(cyclobutylamino)octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S)-1-[8-(cyclobutylamino)octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide?
The IUPAC name of 2-[(3S)-1-[8-(cyclobutylamino)octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide (CID 16755438) is 2-[(3S)-1-[8-(cyclobutylamino)octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide.
What is the SMILES notation for 2-[(3S)-1-[8-(cyclobutylamino)octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide?
The canonical SMILES for 2-[(3S)-1-[8-(cyclobutylamino)octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide is NC(=O)C(c1ccccc1)(c1ccccc1)[C@@H]1CCN(CCCCCCCCNC2CCC2)C1.
What is the InChIKey of 2-[(3S)-1-[8-(cyclobutylamino)octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide?
The InChIKey is GIKPJPDQOSGJIX-HHHXNRCGSA-N. The full InChI is InChI=1S/C30H43N3O/c31-29(34)30(25-14-7-5-8-15-25,26-16-9-6-10-17-26)27-20-23-33(24-27)22-12-4-2-1-3-11-21-32-28-18-13-19-28/h5-10,14-17,27-28,32H,1-4,11-13,18-24H2,(H2,31,34)/t27-/m1/s1.
What are the key properties of 2-[(3S)-1-[8-(cyclobutylamino)octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide?
2-[(3S)-1-[8-(cyclobutylamino)octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide has a molecular weight of 461.69 g/mol, XLogP of 5.26, 14 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S)-1-[8-(cyclobutylamino)octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide is sourced from PubChem (CID 16755438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).