C23H24N6OS — CID 167556323
3-(2,1,3-benzothiadiazol-4-ylmethylamino)-1-[8-(5-ethynyl-2-pyridinyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]propan-1-one (PubChem CID 167556323) has the molecular formula C23H24N6OS and a molecular weight of 432.55 g/mol. Its IUPAC name is 3-(2,1,3-benzothiadiazol-4-ylmethylamino)-1-[8-(5-ethynyl-2-pyridinyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]propan-1-one.
| Compound Name | 3-(2,1,3-benzothiadiazol-4-ylmethylamino)-1-[8-(5-ethynyl-2-pyridinyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]propan-1-one |
|---|---|
| PubChem CID | 167556323 |
| Molecular Formula | C23H24N6OS |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 3-(2,1,3-benzothiadiazol-4-ylmethylamino)-1-[8-(5-ethynyl-2-pyridinyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]propan-1-one |
| SMILES | C#Cc1ccc(N2C3CCC2CN(C(=O)CCNCc2cccc4nsnc24)C3)nc1 |
| InChI | InChI=1S/C23H24N6OS/c1-2-16-6-9-21(25-12-16)29-18-7-8-19(29)15-28(14-18)22(30)10-11-24-13-17-4-3-5-20-23(17)27-31-26-20/h1,3-6,9,12,18-19,24H,7-8,10-11,13-15H2 |
| InChIKey | YFDBEJFOLJAFGH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|