About hydron;pyridine-2,3-dicarboxylate
hydron;pyridine-2,3-dicarboxylate (PubChem CID 16755641) has the molecular formula C7H4NO4-
and a molecular weight of 166.11 g/mol. Its IUPAC name is hydron;pyridine-2,3-dicarboxylate.
Molecular Properties
| Compound Name | hydron;pyridine-2,3-dicarboxylate |
| PubChem CID | 16755641 |
| Molecular Formula | C7H4NO4- |
| Molecular Weight | 166.11 g/mol |
| Exact Mass | 166.01 |
| IUPAC Name | hydron;pyridine-2,3-dicarboxylate |
| SMILES | O=C([O-])c1cccnc1C(=O)[O-].[H+] |
| InChI | InChI=1S/C7H5NO4/c9-6(10)4-2-1-3-8-5(4)7(11)12/h1-3H,(H,9,10)(H,11,12)/p-1 |
| InChIKey | GJAWHXHKYYXBSV-UHFFFAOYSA-M |
| XLogP | -2.08 |
| TPSA | 93.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.11 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze hydron;pyridine-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;pyridine-2,3-dicarboxylate?
The IUPAC name of hydron;pyridine-2,3-dicarboxylate (CID 16755641) is hydron;pyridine-2,3-dicarboxylate.
What is the SMILES notation for hydron;pyridine-2,3-dicarboxylate?
The canonical SMILES for hydron;pyridine-2,3-dicarboxylate is O=C([O-])c1cccnc1C(=O)[O-].[H+].
What is the InChIKey of hydron;pyridine-2,3-dicarboxylate?
The InChIKey is GJAWHXHKYYXBSV-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5NO4/c9-6(10)4-2-1-3-8-5(4)7(11)12/h1-3H,(H,9,10)(H,11,12)/p-1.
What are the key properties of hydron;pyridine-2,3-dicarboxylate?
hydron;pyridine-2,3-dicarboxylate has a molecular weight of 166.11 g/mol, XLogP of -2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;pyridine-2,3-dicarboxylate is sourced from PubChem (CID 16755641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).