About propan-2-yl 3-(2,4-dihydroxyphenyl)propanoate
propan-2-yl 3-(2,4-dihydroxyphenyl)propanoate (PubChem CID 16755666) has the molecular formula C12H16O4
and a molecular weight of 224.26 g/mol. Its IUPAC name is propan-2-yl 3-(2,4-dihydroxyphenyl)propanoate.
Molecular Properties
| Compound Name | propan-2-yl 3-(2,4-dihydroxyphenyl)propanoate |
| PubChem CID | 16755666 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | propan-2-yl 3-(2,4-dihydroxyphenyl)propanoate |
| SMILES | CC(C)OC(=O)CCc1ccc(O)cc1O |
| InChI | InChI=1S/C12H16O4/c1-8(2)16-12(15)6-4-9-3-5-10(13)7-11(9)14/h3,5,7-8,13-14H,4,6H2,1-2H3 |
| InChIKey | ULEKMXRXAWNLHZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl 3-(2,4-dihydroxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 3-(2,4-dihydroxyphenyl)propanoate?
The IUPAC name of propan-2-yl 3-(2,4-dihydroxyphenyl)propanoate (CID 16755666) is propan-2-yl 3-(2,4-dihydroxyphenyl)propanoate.
What is the SMILES notation for propan-2-yl 3-(2,4-dihydroxyphenyl)propanoate?
The canonical SMILES for propan-2-yl 3-(2,4-dihydroxyphenyl)propanoate is CC(C)OC(=O)CCc1ccc(O)cc1O.
What is the InChIKey of propan-2-yl 3-(2,4-dihydroxyphenyl)propanoate?
The InChIKey is ULEKMXRXAWNLHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4/c1-8(2)16-12(15)6-4-9-3-5-10(13)7-11(9)14/h3,5,7-8,13-14H,4,6H2,1-2H3.
What are the key properties of propan-2-yl 3-(2,4-dihydroxyphenyl)propanoate?
propan-2-yl 3-(2,4-dihydroxyphenyl)propanoate has a molecular weight of 224.26 g/mol, XLogP of 1.98, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 3-(2,4-dihydroxyphenyl)propanoate is sourced from PubChem (CID 16755666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).