About 4-methyl-2-[3-[(2R)-1-(1,3,4-oxadiazol-2-yl)propan-2-yl]phenyl]-3H-isoindol-1-one
4-methyl-2-[3-[(2R)-1-(1,3,4-oxadiazol-2-yl)propan-2-yl]phenyl]-3H-isoindol-1-one (PubChem CID 167556743) has the molecular formula C20H19N3O2
and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-methyl-2-[3-[(2R)-1-(1,3,4-oxadiazol-2-yl)propan-2-yl]phenyl]-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 4-methyl-2-[3-[(2R)-1-(1,3,4-oxadiazol-2-yl)propan-2-yl]phenyl]-3H-isoindol-1-one |
| PubChem CID | 167556743 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 4-methyl-2-[3-[(2R)-1-(1,3,4-oxadiazol-2-yl)propan-2-yl]phenyl]-3H-isoindol-1-one |
| SMILES | Cc1cccc2c1CN(c1cccc([C@H](C)Cc3nnco3)c1)C2=O |
| InChI | InChI=1S/C20H19N3O2/c1-13-5-3-8-17-18(13)11-23(20(17)24)16-7-4-6-15(10-16)14(2)9-19-22-21-12-25-19/h3-8,10,12,14H,9,11H2,1-2H3/t14-/m1/s1 |
| InChIKey | DCMCFFSNOQKWSC-CQSZACIVSA-N |
| XLogP | 3.88 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-2-[3-[(2R)-1-(1,3,4-oxadiazol-2-yl)propan-2-yl]phenyl]-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-[3-[(2R)-1-(1,3,4-oxadiazol-2-yl)propan-2-yl]phenyl]-3H-isoindol-1-one?
The IUPAC name of 4-methyl-2-[3-[(2R)-1-(1,3,4-oxadiazol-2-yl)propan-2-yl]phenyl]-3H-isoindol-1-one (CID 167556743) is 4-methyl-2-[3-[(2R)-1-(1,3,4-oxadiazol-2-yl)propan-2-yl]phenyl]-3H-isoindol-1-one.
What is the SMILES notation for 4-methyl-2-[3-[(2R)-1-(1,3,4-oxadiazol-2-yl)propan-2-yl]phenyl]-3H-isoindol-1-one?
The canonical SMILES for 4-methyl-2-[3-[(2R)-1-(1,3,4-oxadiazol-2-yl)propan-2-yl]phenyl]-3H-isoindol-1-one is Cc1cccc2c1CN(c1cccc([C@H](C)Cc3nnco3)c1)C2=O.
What is the InChIKey of 4-methyl-2-[3-[(2R)-1-(1,3,4-oxadiazol-2-yl)propan-2-yl]phenyl]-3H-isoindol-1-one?
The InChIKey is DCMCFFSNOQKWSC-CQSZACIVSA-N. The full InChI is InChI=1S/C20H19N3O2/c1-13-5-3-8-17-18(13)11-23(20(17)24)16-7-4-6-15(10-16)14(2)9-19-22-21-12-25-19/h3-8,10,12,14H,9,11H2,1-2H3/t14-/m1/s1.
What are the key properties of 4-methyl-2-[3-[(2R)-1-(1,3,4-oxadiazol-2-yl)propan-2-yl]phenyl]-3H-isoindol-1-one?
4-methyl-2-[3-[(2R)-1-(1,3,4-oxadiazol-2-yl)propan-2-yl]phenyl]-3H-isoindol-1-one has a molecular weight of 333.39 g/mol, XLogP of 3.88, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-[3-[(2R)-1-(1,3,4-oxadiazol-2-yl)propan-2-yl]phenyl]-3H-isoindol-1-one is sourced from PubChem (CID 167556743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).