C11H19NO2 — CID 167557027
(4R,5R)-4-[(2R)-butan-2-yl]-4-methyl-5-prop-1-en-2-yl-1,3-oxazolidin-2-one (PubChem CID 167557027) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (4R,5R)-4-[(2R)-butan-2-yl]-4-methyl-5-prop-1-en-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-4-[(2R)-butan-2-yl]-4-methyl-5-prop-1-en-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 167557027 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (4R,5R)-4-[(2R)-butan-2-yl]-4-methyl-5-prop-1-en-2-yl-1,3-oxazolidin-2-one |
| SMILES | C=C(C)[C@H]1OC(=O)N[C@]1(C)[C@H](C)CC |
| InChI | InChI=1S/C11H19NO2/c1-6-8(4)11(5)9(7(2)3)14-10(13)12-11/h8-9H,2,6H2,1,3-5H3,(H,12,13)/t8-,9-,11-/m1/s1 |
| InChIKey | VPCZIBMTVSAJNI-FXPVBKGRSA-N |
| XLogP | 2.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|