C32H35F2N5O4 — CID 167557172
(2S)-N-[(2S)-1-cyano-1-(ethylamino)-3-[(1S)-2-oxocyclopentyl]propan-2-yl]-1-[4-(difluoromethoxy)-1H-indole-2-carbonyl]-4-phenylpyrrolidine-2-carboxamide (PubChem CID 167557172) has the molecular formula C32H35F2N5O4 and a molecular weight of 591.66 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-cyano-1-(ethylamino)-3-[(1S)-2-oxocyclopentyl]propan-2-yl]-1-[4-(difluoromethoxy)-1H-indole-2-carbonyl]-4-phenylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-1-cyano-1-(ethylamino)-3-[(1S)-2-oxocyclopentyl]propan-2-yl]-1-[4-(difluoromethoxy)-1H-indole-2-carbonyl]-4-phenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 167557172 |
| Molecular Formula | C32H35F2N5O4 |
| Molecular Weight | 591.66 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | (2S)-N-[(2S)-1-cyano-1-(ethylamino)-3-[(1S)-2-oxocyclopentyl]propan-2-yl]-1-[4-(difluoromethoxy)-1H-indole-2-carbonyl]-4-phenylpyrrolidine-2-carboxamide |
| SMILES | CCNC(C#N)[C@H](C[C@@H]1CCCC1=O)NC(=O)[C@@H]1CC(c2ccccc2)CN1C(=O)c1cc2c(OC(F)F)cccc2[nH]1 |
| InChI | InChI=1S/C32H35F2N5O4/c1-2-36-26(17-35)24(14-20-10-6-12-28(20)40)38-30(41)27-15-21(19-8-4-3-5-9-19)18-39(27)31(42)25-16-22-23(37-25)11-7-13-29(22)43-32(33)34/h3-5,7-9,11,13,16,20-21,24,26-27,32,36-37H,2,6,10,12,14-15,18H2,1H3,(H,38,41)/t20-,21?,24-,26?,27-/m0/s1 |
| InChIKey | DDUOQHQCVXZHFX-GCVQYRMPSA-N |
| XLogP | 4.51 |
| TPSA | 127.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |