C14H18FN3O2S — CID 167557263
[(2S,3R,4S,5R,6S)-5-azido-4-fluoro-3-methyl-6-(4-methylphenyl)sulfanyloxan-2-yl]methanol (PubChem CID 167557263) has the molecular formula C14H18FN3O2S and a molecular weight of 311.38 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6S)-5-azido-4-fluoro-3-methyl-6-(4-methylphenyl)sulfanyloxan-2-yl]methanol.
| Compound Name | [(2S,3R,4S,5R,6S)-5-azido-4-fluoro-3-methyl-6-(4-methylphenyl)sulfanyloxan-2-yl]methanol |
|---|---|
| PubChem CID | 167557263 |
| Molecular Formula | C14H18FN3O2S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | [(2S,3R,4S,5R,6S)-5-azido-4-fluoro-3-methyl-6-(4-methylphenyl)sulfanyloxan-2-yl]methanol |
| SMILES | Cc1ccc(S[C@@H]2O[C@H](CO)[C@@H](C)[C@H](F)[C@H]2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C14H18FN3O2S/c1-8-3-5-10(6-4-8)21-14-13(17-18-16)12(15)9(2)11(7-19)20-14/h3-6,9,11-14,19H,7H2,1-2H3/t9-,11-,12+,13-,14+/m1/s1 |
| InChIKey | DECGFIRWFXAEND-LPUQOGTASA-N |
| XLogP | 3.46 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|