C40H56N4O8 — CID 167557567
3-O-tert-butyl 2-O-methyl (1R,2R,5S)-8-benzyl-3,8-diazabicyclo[3.2.1]octane-2,3-dicarboxylate;3-O-tert-butyl 2-O-methyl (1S,2S,5R)-8-benzyl-3,8-diazabicyclo[3.2.1]octane-2,3-dicarboxylate (PubChem CID 167557567) has the molecular formula C40H56N4O8 and a molecular weight of 720.91 g/mol. Its IUPAC name is 3-O-tert-butyl 2-O-methyl (1R,2R,5S)-8-benzyl-3,8-diazabicyclo[3.2.1]octane-2,3-dicarboxylate;3-O-tert-butyl 2-O-methyl (1S,2S,5R)-8-benzyl-3,8-diazabicyclo[3.2.1]octane-2,3-dicarboxylate.
| Compound Name | 3-O-tert-butyl 2-O-methyl (1R,2R,5S)-8-benzyl-3,8-diazabicyclo[3.2.1]octane-2,3-dicarboxylate;3-O-tert-butyl 2-O-methyl (1S,2S,5R)-8-benzyl-3,8-diazabicyclo[3.2.1]octane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 167557567 |
| Molecular Formula | C40H56N4O8 |
| Molecular Weight | 720.91 g/mol |
| Exact Mass | 720.41 |
| IUPAC Name | 3-O-tert-butyl 2-O-methyl (1R,2R,5S)-8-benzyl-3,8-diazabicyclo[3.2.1]octane-2,3-dicarboxylate;3-O-tert-butyl 2-O-methyl (1S,2S,5R)-8-benzyl-3,8-diazabicyclo[3.2.1]octane-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2CC[C@H](CN1C(=O)OC(C)(C)C)N2Cc1ccccc1.COC(=O)[C@H]1[C@H]2CC[C@@H](CN1C(=O)OC(C)(C)C)N2Cc1ccccc1 |
| InChI | InChI=1S/2C20H28N2O4/c2*1-20(2,3)26-19(24)22-13-15-10-11-16(17(22)18(23)25-4)21(15)12-14-8-6-5-7-9-14/h2*5-9,15-17H,10-13H2,1-4H3/t2*15-,16+,17+/m10/s1 |
| InChIKey | DFCNWZXWQROFML-KDMHFIAKSA-N |
| XLogP | 5.62 |
| TPSA | 118.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.91 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|