About 5-cyclopropyl-7-fluoro-2,2-dimethyl-1,4-dihydroquinolin-3-one
5-cyclopropyl-7-fluoro-2,2-dimethyl-1,4-dihydroquinolin-3-one (PubChem CID 167557724) has the molecular formula C14H16FNO
and a molecular weight of 233.29 g/mol. Its IUPAC name is 5-cyclopropyl-7-fluoro-2,2-dimethyl-1,4-dihydroquinolin-3-one.
Molecular Properties
| Compound Name | 5-cyclopropyl-7-fluoro-2,2-dimethyl-1,4-dihydroquinolin-3-one |
| PubChem CID | 167557724 |
| Molecular Formula | C14H16FNO |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 5-cyclopropyl-7-fluoro-2,2-dimethyl-1,4-dihydroquinolin-3-one |
| SMILES | CC1(C)Nc2cc(F)cc(C3CC3)c2CC1=O |
| InChI | InChI=1S/C14H16FNO/c1-14(2)13(17)7-11-10(8-3-4-8)5-9(15)6-12(11)16-14/h5-6,8,16H,3-4,7H2,1-2H3 |
| InChIKey | JXTNQDBKEQFBRH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cyclopropyl-7-fluoro-2,2-dimethyl-1,4-dihydroquinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-7-fluoro-2,2-dimethyl-1,4-dihydroquinolin-3-one?
The IUPAC name of 5-cyclopropyl-7-fluoro-2,2-dimethyl-1,4-dihydroquinolin-3-one (CID 167557724) is 5-cyclopropyl-7-fluoro-2,2-dimethyl-1,4-dihydroquinolin-3-one.
What is the SMILES notation for 5-cyclopropyl-7-fluoro-2,2-dimethyl-1,4-dihydroquinolin-3-one?
The canonical SMILES for 5-cyclopropyl-7-fluoro-2,2-dimethyl-1,4-dihydroquinolin-3-one is CC1(C)Nc2cc(F)cc(C3CC3)c2CC1=O.
What is the InChIKey of 5-cyclopropyl-7-fluoro-2,2-dimethyl-1,4-dihydroquinolin-3-one?
The InChIKey is JXTNQDBKEQFBRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FNO/c1-14(2)13(17)7-11-10(8-3-4-8)5-9(15)6-12(11)16-14/h5-6,8,16H,3-4,7H2,1-2H3.
What are the key properties of 5-cyclopropyl-7-fluoro-2,2-dimethyl-1,4-dihydroquinolin-3-one?
5-cyclopropyl-7-fluoro-2,2-dimethyl-1,4-dihydroquinolin-3-one has a molecular weight of 233.29 g/mol, XLogP of 3.02, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-7-fluoro-2,2-dimethyl-1,4-dihydroquinolin-3-one is sourced from PubChem (CID 167557724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).